About 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride
4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride (PubChem CID 88632726) has the molecular formula C7H8Cl2N2O6S2
and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride |
| PubChem CID | 88632726 |
| Molecular Formula | C7H8Cl2N2O6S2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride |
| SMILES | CS(=O)(=O)c1nc(Cl)c(C(=O)O)c(S(C)(=O)=O)n1.Cl |
| InChI | InChI=1S/C7H7ClN2O6S2.ClH/c1-17(13,14)5-3(6(11)12)4(8)9-7(10-5)18(2,15)16;/h1-2H3,(H,11,12);1H |
| InChIKey | QRSODFHUEJCUGU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride?
The IUPAC name of 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride (CID 88632726) is 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride?
The canonical SMILES for 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride is CS(=O)(=O)c1nc(Cl)c(C(=O)O)c(S(C)(=O)=O)n1.Cl.
What is the InChIKey of 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride?
The InChIKey is QRSODFHUEJCUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O6S2.ClH/c1-17(13,14)5-3(6(11)12)4(8)9-7(10-5)18(2,15)16;/h1-2H3,(H,11,12);1H.
What are the key properties of 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride?
4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride has a molecular weight of 351.19 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 88632726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).