About 4-(4-aminophenoxy)-2,3-diisocyanatoaniline
4-(4-aminophenoxy)-2,3-diisocyanatoaniline (PubChem CID 88633020) has the molecular formula C14H10N4O3
and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-2,3-diisocyanatoaniline.
Molecular Properties
| Compound Name | 4-(4-aminophenoxy)-2,3-diisocyanatoaniline |
| PubChem CID | 88633020 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(4-aminophenoxy)-2,3-diisocyanatoaniline |
| SMILES | Nc1ccc(Oc2ccc(N)c(N=C=O)c2N=C=O)cc1 |
| InChI | InChI=1S/C14H10N4O3/c15-9-1-3-10(4-2-9)21-12-6-5-11(16)13(17-7-19)14(12)18-8-20/h1-6H,15-16H2 |
| InChIKey | KSCLGWNLOVQMGZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenoxy)-2,3-diisocyanatoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenoxy)-2,3-diisocyanatoaniline?
The IUPAC name of 4-(4-aminophenoxy)-2,3-diisocyanatoaniline (CID 88633020) is 4-(4-aminophenoxy)-2,3-diisocyanatoaniline.
What is the SMILES notation for 4-(4-aminophenoxy)-2,3-diisocyanatoaniline?
The canonical SMILES for 4-(4-aminophenoxy)-2,3-diisocyanatoaniline is Nc1ccc(Oc2ccc(N)c(N=C=O)c2N=C=O)cc1.
What is the InChIKey of 4-(4-aminophenoxy)-2,3-diisocyanatoaniline?
The InChIKey is KSCLGWNLOVQMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O3/c15-9-1-3-10(4-2-9)21-12-6-5-11(16)13(17-7-19)14(12)18-8-20/h1-6H,15-16H2.
What are the key properties of 4-(4-aminophenoxy)-2,3-diisocyanatoaniline?
4-(4-aminophenoxy)-2,3-diisocyanatoaniline has a molecular weight of 282.26 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenoxy)-2,3-diisocyanatoaniline is sourced from PubChem (CID 88633020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).