About 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane
2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane (PubChem CID 88633039) has the molecular formula C10H21ClO3
and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane.
Molecular Properties
| Compound Name | 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane |
| PubChem CID | 88633039 |
| Molecular Formula | C10H21ClO3 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane |
| SMILES | COC(OC(C)C)C(Cl)COC(C)C |
| InChI | InChI=1S/C10H21ClO3/c1-7(2)13-6-9(11)10(12-5)14-8(3)4/h7-10H,6H2,1-5H3 |
| InChIKey | PEKFDBUGMQLMOI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane?
The IUPAC name of 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane (CID 88633039) is 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane.
What is the SMILES notation for 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane?
The canonical SMILES for 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane is COC(OC(C)C)C(Cl)COC(C)C.
What is the InChIKey of 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane?
The InChIKey is PEKFDBUGMQLMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21ClO3/c1-7(2)13-6-9(11)10(12-5)14-8(3)4/h7-10H,6H2,1-5H3.
What are the key properties of 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane?
2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane has a molecular weight of 224.73 g/mol, XLogP of 2.42, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-methoxy-1,3-di(propan-2-yloxy)propane is sourced from PubChem (CID 88633039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).