About fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium)
fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) (PubChem CID 88633476) has the molecular formula C52H46BFO8S2
and a molecular weight of 892.88 g/mol. Its IUPAC name is fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium).
Molecular Properties
| Compound Name | fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) |
| PubChem CID | 88633476 |
| Molecular Formula | C52H46BFO8S2 |
| Molecular Weight | 892.88 g/mol |
| Exact Mass | 892.27 |
| IUPAC Name | fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)[s+]c(-c3ccc(OC)cc3)c2)cc1.COc1ccc(-c2cc(-c3ccc(OC)cc3)[s+]c(-c3ccc(OC)cc3)c2)cc1.[O-]B([O-])F |
| InChI | InChI=1S/2C26H23O3S.BFO2/c2*1-27-22-10-4-18(5-11-22)21-16-25(19-6-12-23(28-2)13-7-19)30-26(17-21)20-8-14-24(29-3)15-9-20;2-1(3)4/h2*4-17H,1-3H3;/q2*+1;-2 |
| InChIKey | VSBLLOHMUKTYML-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 101.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 892.88 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium)?
The IUPAC name of fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) (CID 88633476) is fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium).
What is the SMILES notation for fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium)?
The canonical SMILES for fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) is COc1ccc(-c2cc(-c3ccc(OC)cc3)[s+]c(-c3ccc(OC)cc3)c2)cc1.COc1ccc(-c2cc(-c3ccc(OC)cc3)[s+]c(-c3ccc(OC)cc3)c2)cc1.[O-]B([O-])F.
What is the InChIKey of fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium)?
The InChIKey is VSBLLOHMUKTYML-UHFFFAOYSA-N. The full InChI is InChI=1S/2C26H23O3S.BFO2/c2*1-27-22-10-4-18(5-11-22)21-16-25(19-6-12-23(28-2)13-7-19)30-26(17-21)20-8-14-24(29-3)15-9-20;2-1(3)4/h2*4-17H,1-3H3;/q2*+1;-2.
What are the key properties of fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium)?
fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) has a molecular weight of 892.88 g/mol, XLogP of 11.77, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(dioxido)borane;bis(2,4,6-tris(4-methoxyphenyl)thiopyrylium) is sourced from PubChem (CID 88633476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).