C19H15F3N4O3 — CID 88633556
7-(3-aminopyrrolidin-1-yl)-2,5,6-trifluoro-4-oxo-1-phenyl-1,8-naphthyridine-3-carboxylic acid (PubChem CID 88633556) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-2,5,6-trifluoro-4-oxo-1-phenyl-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-2,5,6-trifluoro-4-oxo-1-phenyl-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 88633556 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-2,5,6-trifluoro-4-oxo-1-phenyl-1,8-naphthyridine-3-carboxylic acid |
| SMILES | NC1CCN(c2nc3c(c(F)c2F)c(=O)c(C(=O)O)c(F)n3-c2ccccc2)C1 |
| InChI | InChI=1S/C19H15F3N4O3/c20-13-11-15(27)12(19(28)29)16(22)26(10-4-2-1-3-5-10)17(11)24-18(14(13)21)25-7-6-9(23)8-25/h1-5,9H,6-8,23H2,(H,28,29) |
| InChIKey | KQEZVUAHHVMPGJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|