C24H24F3NO2S — CID 88633587
(2Z,4E)-3-(4-methoxy-3-methylphenyl)-1-thiomorpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one (PubChem CID 88633587) has the molecular formula C24H24F3NO2S and a molecular weight of 447.52 g/mol. Its IUPAC name is (2Z,4E)-3-(4-methoxy-3-methylphenyl)-1-thiomorpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-3-(4-methoxy-3-methylphenyl)-1-thiomorpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 88633587 |
| Molecular Formula | C24H24F3NO2S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (2Z,4E)-3-(4-methoxy-3-methylphenyl)-1-thiomorpholin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
| SMILES | COc1ccc(C(=C\C(=O)N2CCSCC2)/C=C/c2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C24H24F3NO2S/c1-17-15-19(7-10-22(17)30-2)20(16-23(29)28-11-13-31-14-12-28)6-3-18-4-8-21(9-5-18)24(25,26)27/h3-10,15-16H,11-14H2,1-2H3/b6-3+,20-16- |
| InChIKey | ASJLIDXTJQUIOS-HNLXZMQRSA-N |
| XLogP | 5.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|