C9H7F6NO — CID 88633601
N-(1,1,2,3,3,3-hexafluoropropoxy)aniline (PubChem CID 88633601) has the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. Its IUPAC name is N-(1,1,2,3,3,3-hexafluoropropoxy)aniline.
| Compound Name | N-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
|---|---|
| PubChem CID | 88633601 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| SMILES | FC(C(F)(F)F)C(F)(F)ONc1ccccc1 |
| InChI | InChI=1S/C9H7F6NO/c10-7(8(11,12)13)9(14,15)17-16-6-4-2-1-3-5-6/h1-5,7,16H |
| InChIKey | HZUFEQPPMXLMBX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|