C15H16N4 — CID 88633846
N,N-dimethyl-4-[1-(1,3,5-triazin-2-yl)buta-1,3-dienyl]aniline (PubChem CID 88633846) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(1,3,5-triazin-2-yl)buta-1,3-dienyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-(1,3,5-triazin-2-yl)buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 88633846 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N,N-dimethyl-4-[1-(1,3,5-triazin-2-yl)buta-1,3-dienyl]aniline |
| SMILES | C=CC=C(c1ccc(N(C)C)cc1)c1ncncn1 |
| InChI | InChI=1S/C15H16N4/c1-4-5-14(15-17-10-16-11-18-15)12-6-8-13(9-7-12)19(2)3/h4-11H,1H2,2-3H3 |
| InChIKey | KDTKPSZEBNPGJB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|