About 2-chloropropane;methanol
2-chloropropane;methanol (PubChem CID 88634211) has the molecular formula C4H11ClO
and a molecular weight of 110.58 g/mol. Its IUPAC name is 2-chloropropane;methanol.
Molecular Properties
| Compound Name | 2-chloropropane;methanol |
| PubChem CID | 88634211 |
| Molecular Formula | C4H11ClO |
| Molecular Weight | 110.58 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 2-chloropropane;methanol |
| SMILES | CC(C)Cl.CO |
| InChI | InChI=1S/C3H7Cl.CH4O/c1-3(2)4;1-2/h3H,1-2H3;2H,1H3 |
| InChIKey | LVVLOELQYMIBKO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.58 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropane;methanol?
The IUPAC name of 2-chloropropane;methanol (CID 88634211) is 2-chloropropane;methanol.
What is the SMILES notation for 2-chloropropane;methanol?
The canonical SMILES for 2-chloropropane;methanol is CC(C)Cl.CO.
What is the InChIKey of 2-chloropropane;methanol?
The InChIKey is LVVLOELQYMIBKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7Cl.CH4O/c1-3(2)4;1-2/h3H,1-2H3;2H,1H3.
What are the key properties of 2-chloropropane;methanol?
2-chloropropane;methanol has a molecular weight of 110.58 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropane;methanol is sourced from PubChem (CID 88634211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).