C51H96O6 — CID 88634530
2-methylidenehexadecanoic acid;pentadecyl prop-2-enoate;tridecyl prop-2-enoate (PubChem CID 88634530) has the molecular formula C51H96O6 and a molecular weight of 805.32 g/mol. Its IUPAC name is 2-methylidenehexadecanoic acid;pentadecyl prop-2-enoate;tridecyl prop-2-enoate.
| Compound Name | 2-methylidenehexadecanoic acid;pentadecyl prop-2-enoate;tridecyl prop-2-enoate |
|---|---|
| PubChem CID | 88634530 |
| Molecular Formula | C51H96O6 |
| Molecular Weight | 805.32 g/mol |
| Exact Mass | 804.72 |
| IUPAC Name | 2-methylidenehexadecanoic acid;pentadecyl prop-2-enoate;tridecyl prop-2-enoate |
| SMILES | C=C(CCCCCCCCCCCCCC)C(=O)O.C=CC(=O)OCCCCCCCCCCCCC.C=CC(=O)OCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C18H34O2.C17H32O2.C16H30O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(19)4-2;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17(18)19;1-3-5-6-7-8-9-10-11-12-13-14-15-18-16(17)4-2/h4H,2-3,5-17H2,1H3;2-15H2,1H3,(H,18,19);4H,2-3,5-15H2,1H3 |
| InChIKey | JNMVUTJCGNAZPX-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.32 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|