C25H24F6N4 — CID 88634596
N-[1,4-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (PubChem CID 88634596) has the molecular formula C25H24F6N4 and a molecular weight of 494.48 g/mol. Its IUPAC name is N-[1,4-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine.
| Compound Name | N-[1,4-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 88634596 |
| Molecular Formula | C25H24F6N4 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[1,4-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| SMILES | C=C(C(C=Cc1ccc(C(F)(F)F)cc1)=NNC1=NCC(C)(C)CN1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24F6N4/c1-16(18-7-11-20(12-8-18)25(29,30)31)21(34-35-22-32-14-23(2,3)15-33-22)13-6-17-4-9-19(10-5-17)24(26,27)28/h4-13H,1,14-15H2,2-3H3,(H2,32,33,35) |
| InChIKey | RBWZUKNCMYWIHO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|