About [(4-formylbenzoyl)amino] carbonochloridate
[(4-formylbenzoyl)amino] carbonochloridate (PubChem CID 88635447) has the molecular formula C9H6ClNO4
and a molecular weight of 227.60 g/mol. Its IUPAC name is [(4-formylbenzoyl)amino] carbonochloridate.
Molecular Properties
| Compound Name | [(4-formylbenzoyl)amino] carbonochloridate |
| PubChem CID | 88635447 |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | [(4-formylbenzoyl)amino] carbonochloridate |
| SMILES | O=Cc1ccc(C(=O)NOC(=O)Cl)cc1 |
| InChI | InChI=1S/C9H6ClNO4/c10-9(14)15-11-8(13)7-3-1-6(5-12)2-4-7/h1-5H,(H,11,13) |
| InChIKey | IQQSHTUKNHTWKJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-formylbenzoyl)amino] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-formylbenzoyl)amino] carbonochloridate?
The IUPAC name of [(4-formylbenzoyl)amino] carbonochloridate (CID 88635447) is [(4-formylbenzoyl)amino] carbonochloridate.
What is the SMILES notation for [(4-formylbenzoyl)amino] carbonochloridate?
The canonical SMILES for [(4-formylbenzoyl)amino] carbonochloridate is O=Cc1ccc(C(=O)NOC(=O)Cl)cc1.
What is the InChIKey of [(4-formylbenzoyl)amino] carbonochloridate?
The InChIKey is IQQSHTUKNHTWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO4/c10-9(14)15-11-8(13)7-3-1-6(5-12)2-4-7/h1-5H,(H,11,13).
What are the key properties of [(4-formylbenzoyl)amino] carbonochloridate?
[(4-formylbenzoyl)amino] carbonochloridate has a molecular weight of 227.60 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-formylbenzoyl)amino] carbonochloridate is sourced from PubChem (CID 88635447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).