C37H48F10O2 — CID 88635475
1-[2-(4-ethylcyclohexyl)ethyl]-4-(1,1,2,2,2-pentafluoroethoxy)benzene;1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-(4-propylcyclohexyl)ethyl]benzene (PubChem CID 88635475) has the molecular formula C37H48F10O2 and a molecular weight of 714.77 g/mol. Its IUPAC name is 1-[2-(4-ethylcyclohexyl)ethyl]-4-(1,1,2,2,2-pentafluoroethoxy)benzene;1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-(4-propylcyclohexyl)ethyl]benzene.
| Compound Name | 1-[2-(4-ethylcyclohexyl)ethyl]-4-(1,1,2,2,2-pentafluoroethoxy)benzene;1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-(4-propylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 88635475 |
| Molecular Formula | C37H48F10O2 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | 1-[2-(4-ethylcyclohexyl)ethyl]-4-(1,1,2,2,2-pentafluoroethoxy)benzene;1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-(4-propylcyclohexyl)ethyl]benzene |
| SMILES | CCC1CCC(CCc2ccc(OC(F)(F)C(F)(F)F)cc2)CC1.CCCC1CCC(CCc2ccc(OC(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H25F5O.C18H23F5O/c1-2-3-14-4-6-15(7-5-14)8-9-16-10-12-17(13-11-16)25-19(23,24)18(20,21)22;1-2-13-3-5-14(6-4-13)7-8-15-9-11-16(12-10-15)24-18(22,23)17(19,20)21/h10-15H,2-9H2,1H3;9-14H,2-8H2,1H3 |
| InChIKey | ZMJYRKUUMLRKFO-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|