About (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate
(4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate (PubChem CID 88635638) has the molecular formula C9H11NO7S
and a molecular weight of 277.25 g/mol. Its IUPAC name is (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate.
Molecular Properties
| Compound Name | (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate |
| PubChem CID | 88635638 |
| Molecular Formula | C9H11NO7S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate |
| SMILES | COC1=C(C=O)C=CC(OS(C)(=O)=O)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C9H11NO7S/c1-16-8-5-9(10(12)13,17-18(2,14)15)4-3-7(8)6-11/h3-4,6H,5H2,1-2H3 |
| InChIKey | YWFVJYFQRXHZDU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate?
The IUPAC name of (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate (CID 88635638) is (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate.
What is the SMILES notation for (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate?
The canonical SMILES for (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate is COC1=C(C=O)C=CC(OS(C)(=O)=O)([N+](=O)[O-])C1.
What is the InChIKey of (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate?
The InChIKey is YWFVJYFQRXHZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO7S/c1-16-8-5-9(10(12)13,17-18(2,14)15)4-3-7(8)6-11/h3-4,6H,5H2,1-2H3.
What are the key properties of (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate?
(4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate has a molecular weight of 277.25 g/mol, XLogP of -0.01, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-5-methoxy-1-nitrocyclohexa-2,4-dien-1-yl) methanesulfonate is sourced from PubChem (CID 88635638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).