C19H5N7 — CID 88636042
pyrimido[4,5-a]acridine-2,4,5,6-tetracarbonitrile (PubChem CID 88636042) has the molecular formula C19H5N7 and a molecular weight of 331.30 g/mol. Its IUPAC name is pyrimido[4,5-a]acridine-2,4,5,6-tetracarbonitrile.
| Compound Name | pyrimido[4,5-a]acridine-2,4,5,6-tetracarbonitrile |
|---|---|
| PubChem CID | 88636042 |
| Molecular Formula | C19H5N7 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | pyrimido[4,5-a]acridine-2,4,5,6-tetracarbonitrile |
| SMILES | N#Cc1nc(C#N)c2c(C#N)c(C#N)c3nc4ccccc4cc3c2n1 |
| InChI | InChI=1S/C19H5N7/c20-6-12-13(7-21)18-11(5-10-3-1-2-4-14(10)25-18)19-17(12)15(8-22)24-16(9-23)26-19/h1-5H |
| InChIKey | PZNZCUFMZCBSHX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|