C12H13Cl6P — CID 88636119
1,2,3,4,5,6-hexachlorocyclohexane;phenylphosphane (PubChem CID 88636119) has the molecular formula C12H13Cl6P and a molecular weight of 400.93 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorocyclohexane;phenylphosphane.
| Compound Name | 1,2,3,4,5,6-hexachlorocyclohexane;phenylphosphane |
|---|---|
| PubChem CID | 88636119 |
| Molecular Formula | C12H13Cl6P |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclohexane;phenylphosphane |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.Pc1ccccc1 |
| InChI | InChI=1S/C6H6Cl6.C6H7P/c7-1-2(8)4(10)6(12)5(11)3(1)9;7-6-4-2-1-3-5-6/h1-6H;1-5H,7H2 |
| InChIKey | QJANDUYRIZDHDI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|