C19H12N2O10 — CID 88636362
2-benzoyloxycarbonylterephthalic acid;6-oxa-1,3-diazabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 88636362) has the molecular formula C19H12N2O10 and a molecular weight of 428.31 g/mol. Its IUPAC name is 2-benzoyloxycarbonylterephthalic acid;6-oxa-1,3-diazabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 2-benzoyloxycarbonylterephthalic acid;6-oxa-1,3-diazabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 88636362 |
| Molecular Formula | C19H12N2O10 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-benzoyloxycarbonylterephthalic acid;6-oxa-1,3-diazabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C(O)c1ccc(C(=O)O)c(C(=O)OC(=O)c2ccccc2)c1.O=C1NC(=O)N2OC12 |
| InChI | InChI=1S/C16H10O7.C3H2N2O3/c17-13(18)10-6-7-11(14(19)20)12(8-10)16(22)23-15(21)9-4-2-1-3-5-9;6-1-2-5(8-2)3(7)4-1/h1-8H,(H,17,18)(H,19,20);2H,(H,4,6,7) |
| InChIKey | CYBVTODQLYRIHT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|