About N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine
N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine (PubChem CID 88636612) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine.
Molecular Properties
| Compound Name | N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine |
| PubChem CID | 88636612 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine |
| SMILES | CC#CNCC1=CC=CC(=[N+]=[N-])C1 |
| InChI | InChI=1S/C10H11N3/c1-2-6-12-8-9-4-3-5-10(7-9)13-11/h3-5,12H,7-8H2,1H3 |
| InChIKey | UIIVYSGHBGKPQZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 48.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine?
The IUPAC name of N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine (CID 88636612) is N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine.
What is the SMILES notation for N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine?
The canonical SMILES for N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine is CC#CNCC1=CC=CC(=[N+]=[N-])C1.
What is the InChIKey of N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine?
The InChIKey is UIIVYSGHBGKPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-2-6-12-8-9-4-3-5-10(7-9)13-11/h3-5,12H,7-8H2,1H3.
What are the key properties of N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine?
N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine has a molecular weight of 173.22 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]prop-1-yn-1-amine is sourced from PubChem (CID 88636612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).