About dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate
dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 88636778) has the molecular formula C22H36O4
and a molecular weight of 364.53 g/mol. Its IUPAC name is dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 88636778 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCCCCCC(CCC)OC(=O)C1(OCC2CO2)C=CC=CC1 |
| InChI | InChI=1S/C22H36O4/c1-3-5-6-7-8-10-14-19(13-4-2)26-21(23)22(15-11-9-12-16-22)25-18-20-17-24-20/h9,11-12,15,19-20H,3-8,10,13-14,16-18H2,1-2H3 |
| InChIKey | LHNJTDPAWQWNQM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate (CID 88636778) is dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate is CCCCCCCCC(CCC)OC(=O)C1(OCC2CO2)C=CC=CC1.
What is the InChIKey of dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate?
The InChIKey is LHNJTDPAWQWNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O4/c1-3-5-6-7-8-10-14-19(13-4-2)26-21(23)22(15-11-9-12-16-22)25-18-20-17-24-20/h9,11-12,15,19-20H,3-8,10,13-14,16-18H2,1-2H3.
What are the key properties of dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate?
dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate has a molecular weight of 364.53 g/mol, XLogP of 5.12, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-4-yl 1-(oxiran-2-ylmethoxy)cyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 88636778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).