C7H20ClNO4PSi+ — CID 88636837
[2-[chloro(dimethyl)silyl]-2-phosphonooxyethyl]-trimethylazanium (PubChem CID 88636837) has the molecular formula C7H20ClNO4PSi+ and a molecular weight of 276.75 g/mol. Its IUPAC name is [2-[chloro(dimethyl)silyl]-2-phosphonooxyethyl]-trimethylazanium.
| Compound Name | [2-[chloro(dimethyl)silyl]-2-phosphonooxyethyl]-trimethylazanium |
|---|---|
| PubChem CID | 88636837 |
| Molecular Formula | C7H20ClNO4PSi+ |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [2-[chloro(dimethyl)silyl]-2-phosphonooxyethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(OP(=O)(O)O)[Si](C)(C)Cl |
| InChI | InChI=1S/C7H19ClNO4PSi/c1-9(2,3)6-7(15(4,5)8)13-14(10,11)12/h7H,6H2,1-5H3,(H-,10,11,12)/p+1 |
| InChIKey | FFXNYDOXTLQXGQ-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|