About (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide
(Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide (PubChem CID 88637650) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide.
Molecular Properties
| Compound Name | (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide |
| PubChem CID | 88637650 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide |
| SMILES | CC(C)CCOCCCNC(=O)/C=C\C(N)=O |
| InChI | InChI=1S/C12H22N2O3/c1-10(2)6-9-17-8-3-7-14-12(16)5-4-11(13)15/h4-5,10H,3,6-9H2,1-2H3,(H2,13,15)(H,14,16)/b5-4- |
| InChIKey | IYYXMPPRZMHXNQ-PLNGDYQASA-N |
| XLogP | 0.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide?
The IUPAC name of (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide (CID 88637650) is (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide.
What is the SMILES notation for (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide?
The canonical SMILES for (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide is CC(C)CCOCCCNC(=O)/C=C\C(N)=O.
What is the InChIKey of (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide?
The InChIKey is IYYXMPPRZMHXNQ-PLNGDYQASA-N. The full InChI is InChI=1S/C12H22N2O3/c1-10(2)6-9-17-8-3-7-14-12(16)5-4-11(13)15/h4-5,10H,3,6-9H2,1-2H3,(H2,13,15)(H,14,16)/b5-4-.
What are the key properties of (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide?
(Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide has a molecular weight of 242.32 g/mol, XLogP of 0.60, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-[3-(3-methylbutoxy)propyl]but-2-enediamide is sourced from PubChem (CID 88637650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).