sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid

C10H11NaO7S — CID 88637715

IUPACsodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILESCC1=[C-]C=C(C(=O)O)C(C)C1(C(=O)O)S(=O)(=O)O.[Na+]
InChIInChI=1S/C10H11O7S.Na/c1-5-3-4-7(8(11)12)6(2)10(5,9(13)14)18(15,16)17;/h4,6H,1-2H3,(H,11,12)(H,13,14)(H,15,16,17);/q-1;+1
InChIKeyZKHYOMWFRCPUJI-UHFFFAOYSA-N
MW298.25 g/mol
LogP-2.89
Rot. Bonds3

About sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid

sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 88637715) has the molecular formula C10H11NaO7S and a molecular weight of 298.25 g/mol. Its IUPAC name is sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid.

Molecular Properties

Compound Namesodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid
PubChem CID88637715
Molecular FormulaC10H11NaO7S
Molecular Weight298.25 g/mol
Exact Mass298.01
IUPAC Namesodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid
SMILESCC1=[C-]C=C(C(=O)O)C(C)C1(C(=O)O)S(=O)(=O)O.[Na+]
InChIInChI=1S/C10H11O7S.Na/c1-5-3-4-7(8(11)12)6(2)10(5,9(13)14)18(15,16)17;/h4,6H,1-2H3,(H,11,12)(H,13,14)(H,15,16,17);/q-1;+1
InChIKeyZKHYOMWFRCPUJI-UHFFFAOYSA-N
XLogP-2.89
TPSA128.97 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.25
LogP ≤ 5-2.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The IUPAC name of sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid (CID 88637715) is sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid.
What is the SMILES notation for sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The canonical SMILES for sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid is CC1=[C-]C=C(C(=O)O)C(C)C1(C(=O)O)S(=O)(=O)O.[Na+].
What is the InChIKey of sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
The InChIKey is ZKHYOMWFRCPUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11O7S.Na/c1-5-3-4-7(8(11)12)6(2)10(5,9(13)14)18(15,16)17;/h4,6H,1-2H3,(H,11,12)(H,13,14)(H,15,16,17);/q-1;+1.
What are the key properties of sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid?
sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid has a molecular weight of 298.25 g/mol, XLogP of -2.89, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2,6-dimethyl-1-sulfocyclohexa-3,5-diene-1,3-dicarboxylic acid is sourced from PubChem (CID 88637715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).