About chloronickel;bis(tris(dimethylamino)phosphanium)
chloronickel;bis(tris(dimethylamino)phosphanium) (PubChem CID 88638032) has the molecular formula C12H38ClN6NiP2+2
and a molecular weight of 422.57 g/mol. Its IUPAC name is chloronickel;bis(tris(dimethylamino)phosphanium).
Molecular Properties
| Compound Name | chloronickel;bis(tris(dimethylamino)phosphanium) |
| PubChem CID | 88638032 |
| Molecular Formula | C12H38ClN6NiP2+2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | chloronickel;bis(tris(dimethylamino)phosphanium) |
| SMILES | CN(C)[PH+](N(C)C)N(C)C.CN(C)[PH+](N(C)C)N(C)C.Cl[Ni] |
| InChI | InChI=1S/2C6H18N3P.ClH.Ni/c2*1-7(2)10(8(3)4)9(5)6;;/h2*1-6H3;1H;/q;;;+1/p+1 |
| InChIKey | FBISAVMONAOGQR-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloronickel;bis(tris(dimethylamino)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloronickel;bis(tris(dimethylamino)phosphanium)?
The IUPAC name of chloronickel;bis(tris(dimethylamino)phosphanium) (CID 88638032) is chloronickel;bis(tris(dimethylamino)phosphanium).
What is the SMILES notation for chloronickel;bis(tris(dimethylamino)phosphanium)?
The canonical SMILES for chloronickel;bis(tris(dimethylamino)phosphanium) is CN(C)[PH+](N(C)C)N(C)C.CN(C)[PH+](N(C)C)N(C)C.Cl[Ni].
What is the InChIKey of chloronickel;bis(tris(dimethylamino)phosphanium)?
The InChIKey is FBISAVMONAOGQR-UHFFFAOYSA-O. The full InChI is InChI=1S/2C6H18N3P.ClH.Ni/c2*1-7(2)10(8(3)4)9(5)6;;/h2*1-6H3;1H;/q;;;+1/p+1.
What are the key properties of chloronickel;bis(tris(dimethylamino)phosphanium)?
chloronickel;bis(tris(dimethylamino)phosphanium) has a molecular weight of 422.57 g/mol, XLogP of 1.95, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloronickel;bis(tris(dimethylamino)phosphanium) is sourced from PubChem (CID 88638032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).