About 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole
8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole (PubChem CID 88638496) has the molecular formula C23H20N2O3Se
and a molecular weight of 451.38 g/mol. Its IUPAC name is 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole.
Molecular Properties
| Compound Name | 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole |
| PubChem CID | 88638496 |
| Molecular Formula | C23H20N2O3Se |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole |
| SMILES | COc1cc2c(cc1OCc1cccc3ccccc13)OC(C)(C)c1[se]nnc1-2 |
| InChI | InChI=1S/C23H20N2O3Se/c1-23(2)22-21(24-25-29-22)17-11-19(26-3)20(12-18(17)28-23)27-13-15-9-6-8-14-7-4-5-10-16(14)15/h4-12H,13H2,1-3H3 |
| InChIKey | GZWHFIRQFFISLW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole?
The IUPAC name of 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole (CID 88638496) is 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole.
What is the SMILES notation for 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole?
The canonical SMILES for 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole is COc1cc2c(cc1OCc1cccc3ccccc13)OC(C)(C)c1[se]nnc1-2.
What is the InChIKey of 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole?
The InChIKey is GZWHFIRQFFISLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O3Se/c1-23(2)22-21(24-25-29-22)17-11-19(26-3)20(12-18(17)28-23)27-13-15-9-6-8-14-7-4-5-10-16(14)15/h4-12H,13H2,1-3H3.
What are the key properties of 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole?
8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole has a molecular weight of 451.38 g/mol, XLogP of 4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4,4-dimethyl-7-(naphthalen-1-ylmethoxy)chromeno[4,3-d]selenadiazole is sourced from PubChem (CID 88638496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).