About ethane-1,1-diamine;ethane-1,2-diol
ethane-1,1-diamine;ethane-1,2-diol (PubChem CID 88638607) has the molecular formula C4H14N2O2
and a molecular weight of 122.17 g/mol. Its IUPAC name is ethane-1,1-diamine;ethane-1,2-diol.
Molecular Properties
| Compound Name | ethane-1,1-diamine;ethane-1,2-diol |
| PubChem CID | 88638607 |
| Molecular Formula | C4H14N2O2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | ethane-1,1-diamine;ethane-1,2-diol |
| SMILES | CC(N)N.OCCO |
| InChI | InChI=1S/C2H8N2.C2H6O2/c1-2(3)4;3-1-2-4/h2H,3-4H2,1H3;3-4H,1-2H2 |
| InChIKey | YIIWDXLVGAGFLG-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1-diamine;ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1-diamine;ethane-1,2-diol?
The IUPAC name of ethane-1,1-diamine;ethane-1,2-diol (CID 88638607) is ethane-1,1-diamine;ethane-1,2-diol.
What is the SMILES notation for ethane-1,1-diamine;ethane-1,2-diol?
The canonical SMILES for ethane-1,1-diamine;ethane-1,2-diol is CC(N)N.OCCO.
What is the InChIKey of ethane-1,1-diamine;ethane-1,2-diol?
The InChIKey is YIIWDXLVGAGFLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2.C2H6O2/c1-2(3)4;3-1-2-4/h2H,3-4H2,1H3;3-4H,1-2H2.
What are the key properties of ethane-1,1-diamine;ethane-1,2-diol?
ethane-1,1-diamine;ethane-1,2-diol has a molecular weight of 122.17 g/mol, XLogP of -1.78, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1-diamine;ethane-1,2-diol is sourced from PubChem (CID 88638607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).