C8H8O5 — CID 88638675
1,3,5-trihydroxycyclohexa-3,5-diene-1,2-dicarbaldehyde (PubChem CID 88638675) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 1,3,5-trihydroxycyclohexa-3,5-diene-1,2-dicarbaldehyde.
| Compound Name | 1,3,5-trihydroxycyclohexa-3,5-diene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 88638675 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 1,3,5-trihydroxycyclohexa-3,5-diene-1,2-dicarbaldehyde |
| SMILES | O=CC1C(O)=CC(O)=CC1(O)C=O |
| InChI | InChI=1S/C8H8O5/c9-3-6-7(12)1-5(11)2-8(6,13)4-10/h1-4,6,11-13H |
| InChIKey | KGZACMXNGHFTCN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|