About diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate
diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate (PubChem CID 88638690) has the molecular formula C16H21N2O6PSe
and a molecular weight of 447.29 g/mol. Its IUPAC name is diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate.
Molecular Properties
| Compound Name | diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate |
| PubChem CID | 88638690 |
| Molecular Formula | C16H21N2O6PSe |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cc2c(cc1OC)-c1nn[se]c1C(C)(C)O2 |
| InChI | InChI=1S/C16H21N2O6PSe/c1-6-21-25(19,22-7-2)24-13-9-11-10(8-12(13)20-5)14-15(26-18-17-14)16(3,4)23-11/h8-9H,6-7H2,1-5H3 |
| InChIKey | NWDQRLHQXUTYGI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate?
The IUPAC name of diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate (CID 88638690) is diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate.
What is the SMILES notation for diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate?
The canonical SMILES for diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate is CCOP(=O)(OCC)Oc1cc2c(cc1OC)-c1nn[se]c1C(C)(C)O2.
What is the InChIKey of diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate?
The InChIKey is NWDQRLHQXUTYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N2O6PSe/c1-6-21-25(19,22-7-2)24-13-9-11-10(8-12(13)20-5)14-15(26-18-17-14)16(3,4)23-11/h8-9H,6-7H2,1-5H3.
What are the key properties of diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate?
diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate has a molecular weight of 447.29 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (8-methoxy-4,4-dimethylchromeno[4,3-d]selenadiazol-7-yl) phosphate is sourced from PubChem (CID 88638690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).