About 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one
5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one (PubChem CID 88638845) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one |
| PubChem CID | 88638845 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one |
| SMILES | CC1(C)CC(=O)c2cc3ooc3cc2O1 |
| InChI | InChI=1S/C11H10O4/c1-11(2)5-7(12)6-3-9-10(15-14-9)4-8(6)13-11/h3-4H,5H2,1-2H3 |
| InChIKey | DTJPROPKOJHFEE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one?
The IUPAC name of 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one (CID 88638845) is 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one.
What is the SMILES notation for 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one?
The canonical SMILES for 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one is CC1(C)CC(=O)c2cc3ooc3cc2O1.
What is the InChIKey of 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one?
The InChIKey is DTJPROPKOJHFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c1-11(2)5-7(12)6-3-9-10(15-14-9)4-8(6)13-11/h3-4H,5H2,1-2H3.
What are the key properties of 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one?
5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one has a molecular weight of 206.20 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6H-dioxeto[3,4-g]chromen-7-one is sourced from PubChem (CID 88638845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).