About 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol
6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol (PubChem CID 88638911) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol |
| PubChem CID | 88638911 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol |
| SMILES | NC1(N)C=CC(c2ccccc2)=CC1S |
| InChI | InChI=1S/C12H14N2S/c13-12(14)7-6-10(8-11(12)15)9-4-2-1-3-5-9/h1-8,11,15H,13-14H2 |
| InChIKey | LOUYLCURQFPXLY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol?
The IUPAC name of 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol (CID 88638911) is 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol?
The canonical SMILES for 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol is NC1(N)C=CC(c2ccccc2)=CC1S.
What is the InChIKey of 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol?
The InChIKey is LOUYLCURQFPXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c13-12(14)7-6-10(8-11(12)15)9-4-2-1-3-5-9/h1-8,11,15H,13-14H2.
What are the key properties of 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol?
6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol has a molecular weight of 218.32 g/mol, XLogP of 1.55, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diamino-3-phenylcyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 88638911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).