About sodium;3-aminobenzenesulfonate;azete
sodium;3-aminobenzenesulfonate;azete (PubChem CID 88639402) has the molecular formula C9H9N2NaO3S
and a molecular weight of 248.24 g/mol. Its IUPAC name is sodium;3-aminobenzenesulfonate;azete.
Molecular Properties
| Compound Name | sodium;3-aminobenzenesulfonate;azete |
| PubChem CID | 88639402 |
| Molecular Formula | C9H9N2NaO3S |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | sodium;3-aminobenzenesulfonate;azete |
| SMILES | C1=CN=C1.Nc1cccc(S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C6H7NO3S.C3H3N.Na/c7-5-2-1-3-6(4-5)11(8,9)10;1-2-4-3-1;/h1-4H,7H2,(H,8,9,10);1-3H;/q;;+1/p-1 |
| InChIKey | FMIPPJBHMQRIHC-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-aminobenzenesulfonate;azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-aminobenzenesulfonate;azete?
The IUPAC name of sodium;3-aminobenzenesulfonate;azete (CID 88639402) is sodium;3-aminobenzenesulfonate;azete.
What is the SMILES notation for sodium;3-aminobenzenesulfonate;azete?
The canonical SMILES for sodium;3-aminobenzenesulfonate;azete is C1=CN=C1.Nc1cccc(S(=O)(=O)[O-])c1.[Na+].
What is the InChIKey of sodium;3-aminobenzenesulfonate;azete?
The InChIKey is FMIPPJBHMQRIHC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3S.C3H3N.Na/c7-5-2-1-3-6(4-5)11(8,9)10;1-2-4-3-1;/h1-4H,7H2,(H,8,9,10);1-3H;/q;;+1/p-1.
What are the key properties of sodium;3-aminobenzenesulfonate;azete?
sodium;3-aminobenzenesulfonate;azete has a molecular weight of 248.24 g/mol, XLogP of -2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-aminobenzenesulfonate;azete is sourced from PubChem (CID 88639402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).