C11H14F3N3O3S2 — CID 88639597
carbamothioic S-acid;O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate (PubChem CID 88639597) has the molecular formula C11H14F3N3O3S2 and a molecular weight of 357.38 g/mol. Its IUPAC name is carbamothioic S-acid;O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate.
| Compound Name | carbamothioic S-acid;O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate |
|---|---|
| PubChem CID | 88639597 |
| Molecular Formula | C11H14F3N3O3S2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | carbamothioic S-acid;O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate |
| SMILES | Cc1nc(NC(=S)OCCC(F)=C(F)F)oc1C.NC(=O)S |
| InChI | InChI=1S/C10H11F3N2O2S.CH3NOS/c1-5-6(2)17-9(14-5)15-10(18)16-4-3-7(11)8(12)13;2-1(3)4/h3-4H2,1-2H3,(H,14,15,18);(H3,2,3,4) |
| InChIKey | FWKVEIMVCGTIRR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|