C10H11F3N2O2S — CID 88639598
O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate (PubChem CID 88639598) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate.
| Compound Name | O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate |
|---|---|
| PubChem CID | 88639598 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | O-(3,4,4-trifluorobut-3-enyl) N-(4,5-dimethyl-1,3-oxazol-2-yl)carbamothioate |
| SMILES | Cc1nc(NC(=S)OCCC(F)=C(F)F)oc1C |
| InChI | InChI=1S/C10H11F3N2O2S/c1-5-6(2)17-9(14-5)15-10(18)16-4-3-7(11)8(12)13/h3-4H2,1-2H3,(H,14,15,18) |
| InChIKey | AJXUUZMPEPAPAA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|