C20H19F17 — CID 88639757
7-butyl-9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadec-7-en-5-yne (PubChem CID 88639757) has the molecular formula C20H19F17 and a molecular weight of 582.34 g/mol. Its IUPAC name is 7-butyl-9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadec-7-en-5-yne.
| Compound Name | 7-butyl-9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadec-7-en-5-yne |
|---|---|
| PubChem CID | 88639757 |
| Molecular Formula | C20H19F17 |
| Molecular Weight | 582.34 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | 7-butyl-9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadec-7-en-5-yne |
| SMILES | CCCCC#CC(=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC |
| InChI | InChI=1S/C20H19F17/c1-3-5-7-8-10-12(9-6-4-2)11-13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h11H,3-7,9H2,1-2H3 |
| InChIKey | VVJHKAZUQMBYLE-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.34 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|