About butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde
butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde (PubChem CID 88639897) has the molecular formula C20H38O3
and a molecular weight of 326.52 g/mol. Its IUPAC name is butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde.
Molecular Properties
| Compound Name | butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde |
| PubChem CID | 88639897 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde |
| SMILES | C=C(C)C1CC=C(C=O)CC1.CCCC.CCOC(C)OCC |
| InChI | InChI=1S/C10H14O.C6H14O2.C4H10/c1-8(2)10-5-3-9(7-11)4-6-10;1-4-7-6(3)8-5-2;1-3-4-2/h3,7,10H,1,4-6H2,2H3;6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | PDIMBCCWEACYTD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde?
The IUPAC name of butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde (CID 88639897) is butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde.
What is the SMILES notation for butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde?
The canonical SMILES for butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde is C=C(C)C1CC=C(C=O)CC1.CCCC.CCOC(C)OCC.
What is the InChIKey of butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde?
The InChIKey is PDIMBCCWEACYTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C6H14O2.C4H10/c1-8(2)10-5-3-9(7-11)4-6-10;1-4-7-6(3)8-5-2;1-3-4-2/h3,7,10H,1,4-6H2,2H3;6H,4-5H2,1-3H3;3-4H2,1-2H3.
What are the key properties of butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde?
butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde has a molecular weight of 326.52 g/mol, XLogP of 5.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1,1-diethoxyethane;4-prop-1-en-2-ylcyclohexene-1-carbaldehyde is sourced from PubChem (CID 88639897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).