About 1,3-diethylbenzene
1,3-diethylbenzene (PubChem CID 8864) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 1,3-diethylbenzene.
Molecular Properties
| Compound Name | 1,3-diethylbenzene |
| PubChem CID | 8864 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1,3-diethylbenzene |
| SMILES | CCc1cccc(CC)c1 |
| InChI | InChI=1S/C10H14/c1-3-9-6-5-7-10(4-2)8-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | AFZZYIJIWUTJFO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethylbenzene?
The IUPAC name of 1,3-diethylbenzene (CID 8864) is 1,3-diethylbenzene.
What is the SMILES notation for 1,3-diethylbenzene?
The canonical SMILES for 1,3-diethylbenzene is CCc1cccc(CC)c1.
What is the InChIKey of 1,3-diethylbenzene?
The InChIKey is AFZZYIJIWUTJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-3-9-6-5-7-10(4-2)8-9/h5-8H,3-4H2,1-2H3.
What are the key properties of 1,3-diethylbenzene?
1,3-diethylbenzene has a molecular weight of 134.22 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethylbenzene is sourced from PubChem (CID 8864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).