C9H13BrN2O6 — CID 88640439
5-bromo-1H-pyrimidine-2,4-dione;(3S,4R)-3,4,5-trihydroxypentanal (PubChem CID 88640439) has the molecular formula C9H13BrN2O6 and a molecular weight of 325.12 g/mol. Its IUPAC name is 5-bromo-1H-pyrimidine-2,4-dione;(3S,4R)-3,4,5-trihydroxypentanal.
| Compound Name | 5-bromo-1H-pyrimidine-2,4-dione;(3S,4R)-3,4,5-trihydroxypentanal |
|---|---|
| PubChem CID | 88640439 |
| Molecular Formula | C9H13BrN2O6 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5-bromo-1H-pyrimidine-2,4-dione;(3S,4R)-3,4,5-trihydroxypentanal |
| SMILES | O=CC[C@H](O)[C@H](O)CO.O=c1[nH]cc(Br)c(=O)[nH]1 |
| InChI | InChI=1S/C5H10O4.C4H3BrN2O2/c6-2-1-4(8)5(9)3-7;5-2-1-6-4(9)7-3(2)8/h2,4-5,7-9H,1,3H2;1H,(H2,6,7,8,9)/t4-,5+;/m0./s1 |
| InChIKey | WYLZBTPZWVDBPQ-UYXJWNHNSA-N |
| XLogP | -1.88 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|