C22H37NO5Si — CID 88640508
3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-(2,2,5-trimethyl-1,3-dioxolan-4-yl)propanoic acid (PubChem CID 88640508) has the molecular formula C22H37NO5Si and a molecular weight of 423.63 g/mol. Its IUPAC name is 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-(2,2,5-trimethyl-1,3-dioxolan-4-yl)propanoic acid.
| Compound Name | 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-(2,2,5-trimethyl-1,3-dioxolan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 88640508 |
| Molecular Formula | C22H37NO5Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-(2,2,5-trimethyl-1,3-dioxolan-4-yl)propanoic acid |
| SMILES | CC1OC(C)(C)OC1C(CC(=O)O)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO5Si/c1-16-20(27-22(5,6)26-16)18(14-19(24)25)23(15-17-12-10-9-11-13-17)28-29(7,8)21(2,3)4/h9-13,16,18,20H,14-15H2,1-8H3,(H,24,25) |
| InChIKey | CDKIRMUIGHEWGX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|