C32H50O9 — CID 88640876
acetyl decanoate;(1S,2S,6R,10S,11R,13S,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one (PubChem CID 88640876) has the molecular formula C32H50O9 and a molecular weight of 578.74 g/mol. Its IUPAC name is acetyl decanoate;(1S,2S,6R,10S,11R,13S,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one.
| Compound Name | acetyl decanoate;(1S,2S,6R,10S,11R,13S,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
|---|---|
| PubChem CID | 88640876 |
| Molecular Formula | C32H50O9 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | acetyl decanoate;(1S,2S,6R,10S,11R,13S,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)[C@@H](O)[C@]4(O)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C.CCCCCCCCCC(=O)OC(C)=O |
| InChI | InChI=1S/C20H28O6.C12H22O3/c1-9-5-13-18(24,15(9)22)7-11(8-21)6-12-14-17(3,4)20(14,26)16(23)10(2)19(12,13)25;1-3-4-5-6-7-8-9-10-12(14)15-11(2)13/h5-6,10,12-14,16,21,23-26H,7-8H2,1-4H3;3-10H2,1-2H3/t10-,12+,13-,14-,16-,18-,19-,20-;/m1./s1 |
| InChIKey | HUAZZHUROFDVGJ-RHQXLFEISA-N |
| XLogP | 3.15 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|