C10H15N3O4S — CID 88641010
(2-methyl-5-oxo-3-sulfanylidene-1,2,4-triazin-6-yl)oxymethyl 2,2-dimethylpropanoate (PubChem CID 88641010) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is (2-methyl-5-oxo-3-sulfanylidene-1,2,4-triazin-6-yl)oxymethyl 2,2-dimethylpropanoate.
| Compound Name | (2-methyl-5-oxo-3-sulfanylidene-1,2,4-triazin-6-yl)oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88641010 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (2-methyl-5-oxo-3-sulfanylidene-1,2,4-triazin-6-yl)oxymethyl 2,2-dimethylpropanoate |
| SMILES | Cn1nc(OCOC(=O)C(C)(C)C)c(=O)[nH]c1=S |
| InChI | InChI=1S/C10H15N3O4S/c1-10(2,3)8(15)17-5-16-7-6(14)11-9(18)13(4)12-7/h5H2,1-4H3,(H,11,14,18) |
| InChIKey | XJJWBCSUSSNULQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|