1-cyclopentyl-2-methylbenzene;isocyanic acid

C14H18N2O2 — CID 88641039

IUPAC1-cyclopentyl-2-methylbenzene;isocyanic acid
SMILESCc1ccccc1C1CCCC1.N=C=O.N=C=O
InChIInChI=1S/C12H16.2CHNO/c1-10-6-2-5-9-12(10)11-7-3-4-8-11;2*2-1-3/h2,5-6,9,11H,3-4,7-8H2,1H3;2*2H
InChIKeyDKUQQXAPGOSJQW-UHFFFAOYSA-N
MW246.31 g/mol
LogP3.45
Rot. Bonds1

About 1-cyclopentyl-2-methylbenzene;isocyanic acid

1-cyclopentyl-2-methylbenzene;isocyanic acid (PubChem CID 88641039) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-cyclopentyl-2-methylbenzene;isocyanic acid.

Molecular Properties

Compound Name1-cyclopentyl-2-methylbenzene;isocyanic acid
PubChem CID88641039
Molecular FormulaC14H18N2O2
Molecular Weight246.31 g/mol
Exact Mass246.14
IUPAC Name1-cyclopentyl-2-methylbenzene;isocyanic acid
SMILESCc1ccccc1C1CCCC1.N=C=O.N=C=O
InChIInChI=1S/C12H16.2CHNO/c1-10-6-2-5-9-12(10)11-7-3-4-8-11;2*2-1-3/h2,5-6,9,11H,3-4,7-8H2,1H3;2*2H
InChIKeyDKUQQXAPGOSJQW-UHFFFAOYSA-N
XLogP3.45
TPSA81.84 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 53.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze 1-cyclopentyl-2-methylbenzene;isocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-cyclopentyl-2-methylbenzene;isocyanic acid?
The IUPAC name of 1-cyclopentyl-2-methylbenzene;isocyanic acid (CID 88641039) is 1-cyclopentyl-2-methylbenzene;isocyanic acid.
What is the SMILES notation for 1-cyclopentyl-2-methylbenzene;isocyanic acid?
The canonical SMILES for 1-cyclopentyl-2-methylbenzene;isocyanic acid is Cc1ccccc1C1CCCC1.N=C=O.N=C=O.
What is the InChIKey of 1-cyclopentyl-2-methylbenzene;isocyanic acid?
The InChIKey is DKUQQXAPGOSJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.2CHNO/c1-10-6-2-5-9-12(10)11-7-3-4-8-11;2*2-1-3/h2,5-6,9,11H,3-4,7-8H2,1H3;2*2H.
What are the key properties of 1-cyclopentyl-2-methylbenzene;isocyanic acid?
1-cyclopentyl-2-methylbenzene;isocyanic acid has a molecular weight of 246.31 g/mol, XLogP of 3.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2-methylbenzene;isocyanic acid is sourced from PubChem (CID 88641039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).