C12H7Cl3N2O2S — CID 88641123
(Z)-2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoic acid (PubChem CID 88641123) has the molecular formula C12H7Cl3N2O2S and a molecular weight of 349.63 g/mol. Its IUPAC name is (Z)-2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 88641123 |
| Molecular Formula | C12H7Cl3N2O2S |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | (Z)-2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoic acid |
| SMILES | Nc1nc(/C(=C/c2c(Cl)ccc(Cl)c2Cl)C(=O)O)cs1 |
| InChI | InChI=1S/C12H7Cl3N2O2S/c13-7-1-2-8(14)10(15)5(7)3-6(11(18)19)9-4-20-12(16)17-9/h1-4H,(H2,16,17)(H,18,19)/b6-3- |
| InChIKey | QRYUBLZRAQNVMZ-UTCJRWHESA-N |
| XLogP | 4.31 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|