C8H8AgNO6 — CID 88641590
silver;3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione;nitrate (PubChem CID 88641590) has the molecular formula C8H8AgNO6 and a molecular weight of 322.02 g/mol. Its IUPAC name is silver;3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione;nitrate.
| Compound Name | silver;3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione;nitrate |
|---|---|
| PubChem CID | 88641590 |
| Molecular Formula | C8H8AgNO6 |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | silver;3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione;nitrate |
| SMILES | O=C1OC(=O)C2CC=CCC12.O=[N+]([O-])[O-].[Ag+] |
| InChI | InChI=1S/C8H8O3.Ag.NO3/c9-7-5-3-1-2-4-6(5)8(10)11-7;;2-1(3)4/h1-2,5-6H,3-4H2;;/q;+1;-1 |
| InChIKey | WIJJSBJHMVBDLO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|