C21H28O4S2 — CID 88641629
2,2-di(propan-2-yl)-1,3-dithiolane;2-(1H-inden-2-yl)propanedioic acid (PubChem CID 88641629) has the molecular formula C21H28O4S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2,2-di(propan-2-yl)-1,3-dithiolane;2-(1H-inden-2-yl)propanedioic acid.
| Compound Name | 2,2-di(propan-2-yl)-1,3-dithiolane;2-(1H-inden-2-yl)propanedioic acid |
|---|---|
| PubChem CID | 88641629 |
| Molecular Formula | C21H28O4S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2,2-di(propan-2-yl)-1,3-dithiolane;2-(1H-inden-2-yl)propanedioic acid |
| SMILES | CC(C)C1(C(C)C)SCCS1.O=C(O)C(C(=O)O)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C12H10O4.C9H18S2/c13-11(14)10(12(15)16)9-5-7-3-1-2-4-8(7)6-9;1-7(2)9(8(3)4)10-5-6-11-9/h1-5,10H,6H2,(H,13,14)(H,15,16);7-8H,5-6H2,1-4H3 |
| InChIKey | HNUXRRRMEFWKCF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|