C15H19FN6O4S — CID 88642309
5-fluoro-2,4-dioxo-N-[1-(1,3-thiazol-2-ylcarbamoylamino)hexyl]pyrimidine-1-carboxamide (PubChem CID 88642309) has the molecular formula C15H19FN6O4S and a molecular weight of 398.42 g/mol. Its IUPAC name is 5-fluoro-2,4-dioxo-N-[1-(1,3-thiazol-2-ylcarbamoylamino)hexyl]pyrimidine-1-carboxamide.
| Compound Name | 5-fluoro-2,4-dioxo-N-[1-(1,3-thiazol-2-ylcarbamoylamino)hexyl]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 88642309 |
| Molecular Formula | C15H19FN6O4S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-fluoro-2,4-dioxo-N-[1-(1,3-thiazol-2-ylcarbamoylamino)hexyl]pyrimidine-1-carboxamide |
| SMILES | CCCCCC(NC(=O)Nc1nccs1)NC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H19FN6O4S/c1-2-3-4-5-10(18-12(24)21-13-17-6-7-27-13)19-14(25)22-8-9(16)11(23)20-15(22)26/h6-8,10H,2-5H2,1H3,(H,19,25)(H,20,23,26)(H2,17,18,21,24) |
| InChIKey | IMKSRPLCBPVOJF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|