C23H41NO2 — CID 88642400
(6E,10E)-N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide (PubChem CID 88642400) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is (6E,10E)-N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide.
| Compound Name | (6E,10E)-N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide |
|---|---|
| PubChem CID | 88642400 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | (6E,10E)-N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-6,10,14-trienamide |
| SMILES | CCC(O)NC(=O)CC(C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H41NO2/c1-7-22(25)24-23(26)17-21(6)16-10-15-20(5)14-9-13-19(4)12-8-11-18(2)3/h11,13,15,21-22,25H,7-10,12,14,16-17H2,1-6H3,(H,24,26)/b19-13+,20-15+ |
| InChIKey | BIIJEBGKLZZNPU-YLYRKCBPSA-N |
| XLogP | 6.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|