About CID 88642661
CID 88642661 (PubChem CID 88642661) has the molecular formula C6H5BaNO3
and a molecular weight of 276.44 g/mol.
Molecular Properties
| Compound Name | CID 88642661 |
| PubChem CID | 88642661 |
| Molecular Formula | C6H5BaNO3 |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.93 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc[nH]c1=O.[Ba] |
| InChI | InChI=1S/C6H5NO3.Ba/c8-5-4(6(9)10)2-1-3-7-5;/h1-3H,(H,7,8)(H,9,10); |
| InChIKey | ACVFTWUMJJRTBP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 88642661 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88642661?
The IUPAC name of CID 88642661 (CID 88642661) is not available.
What is the SMILES notation for CID 88642661?
The canonical SMILES for CID 88642661 is O=C(O)c1ccc[nH]c1=O.[Ba].
What is the InChIKey of CID 88642661?
The InChIKey is ACVFTWUMJJRTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.Ba/c8-5-4(6(9)10)2-1-3-7-5;/h1-3H,(H,7,8)(H,9,10);.
What are the key properties of CID 88642661?
CID 88642661 has a molecular weight of 276.44 g/mol, XLogP of -0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88642661 is sourced from PubChem (CID 88642661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).