C14H18N2O8Pb2 — CID 88642726
2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;bis(lead(2+)) (PubChem CID 88642726) has the molecular formula C14H18N2O8Pb2 and a molecular weight of 756.70 g/mol. Its IUPAC name is 2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;bis(lead(2+)).
| Compound Name | 2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;bis(lead(2+)) |
|---|---|
| PubChem CID | 88642726 |
| Molecular Formula | C14H18N2O8Pb2 |
| Molecular Weight | 756.70 g/mol |
| Exact Mass | 758.06 |
| IUPAC Name | 2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;bis(lead(2+)) |
| SMILES | NC1(N)CCCC(CC(=O)[O-])(CC(=O)[O-])C1(CC(=O)[O-])CC(=O)[O-].[Pb+2].[Pb+2] |
| InChI | InChI=1S/C14H22N2O8.2Pb/c15-14(16)3-1-2-12(4-8(17)18,5-9(19)20)13(14,6-10(21)22)7-11(23)24;;/h1-7,15-16H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24);;/q;2*+2/p-4 |
| InChIKey | OYEUXXMQIPKGQC-UHFFFAOYSA-J |
| XLogP | -6.44 |
| TPSA | 212.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.70 |
| LogP ≤ 5 | -6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|