About (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide
(Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide (PubChem CID 88643552) has the molecular formula C10H16N4O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide.
Molecular Properties
| Compound Name | (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide |
| PubChem CID | 88643552 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide |
| SMILES | NNC(=O)/C=C\C(=O)N(CC1CO1)NCC1CO1 |
| InChI | InChI=1S/C10H16N4O4/c11-13-9(15)1-2-10(16)14(4-8-6-18-8)12-3-7-5-17-7/h1-2,7-8,12H,3-6,11H2,(H,13,15)/b2-1- |
| InChIKey | CRPDQCXCHCATIW-UPHRSURJSA-N |
| XLogP | -2.34 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide?
The IUPAC name of (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide (CID 88643552) is (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide.
What is the SMILES notation for (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide?
The canonical SMILES for (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide is NNC(=O)/C=C\C(=O)N(CC1CO1)NCC1CO1.
What is the InChIKey of (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide?
The InChIKey is CRPDQCXCHCATIW-UPHRSURJSA-N. The full InChI is InChI=1S/C10H16N4O4/c11-13-9(15)1-2-10(16)14(4-8-6-18-8)12-3-7-5-17-7/h1-2,7-8,12H,3-6,11H2,(H,13,15)/b2-1-.
What are the key properties of (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide?
(Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide has a molecular weight of 256.26 g/mol, XLogP of -2.34, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-N,4-N'-bis(oxiran-2-ylmethyl)but-2-enedihydrazide is sourced from PubChem (CID 88643552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).