C17H22F2O3 — CID 88644327
(4S)-4-fluoro-1-[(4'S,7'R)-7'-fluorospiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]hept-2-ene]-7'-yl]oct-1-en-3-one (PubChem CID 88644327) has the molecular formula C17H22F2O3 and a molecular weight of 312.36 g/mol. Its IUPAC name is (4S)-4-fluoro-1-[(4'S,7'R)-7'-fluorospiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]hept-2-ene]-7'-yl]oct-1-en-3-one.
| Compound Name | (4S)-4-fluoro-1-[(4'S,7'R)-7'-fluorospiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]hept-2-ene]-7'-yl]oct-1-en-3-one |
|---|---|
| PubChem CID | 88644327 |
| Molecular Formula | C17H22F2O3 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (4S)-4-fluoro-1-[(4'S,7'R)-7'-fluorospiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]hept-2-ene]-7'-yl]oct-1-en-3-one |
| SMILES | CCCC[C@H](F)C(=O)C=C[C@@]1(F)C2C=C[C@H]1C1(C2)OCCO1 |
| InChI | InChI=1S/C17H22F2O3/c1-2-3-4-13(18)14(20)7-8-16(19)12-5-6-15(16)17(11-12)21-9-10-22-17/h5-8,12-13,15H,2-4,9-11H2,1H3/t12?,13-,15+,16+/m0/s1 |
| InChIKey | ZFXHMYLEAGLPRL-CCQOOCRRSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|