About carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine
carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine (PubChem CID 88644555) has the molecular formula C7H10N2O3S
and a molecular weight of 202.24 g/mol. Its IUPAC name is carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine |
| PubChem CID | 88644555 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine |
| SMILES | CC=Cc1csc(N)n1.O=C(O)O |
| InChI | InChI=1S/C6H8N2S.CH2O3/c1-2-3-5-4-9-6(7)8-5;2-1(3)4/h2-4H,1H3,(H2,7,8);(H2,2,3,4) |
| InChIKey | QNRQQCSYSGKYAO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine?
The IUPAC name of carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine (CID 88644555) is carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine.
What is the SMILES notation for carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine?
The canonical SMILES for carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine is CC=Cc1csc(N)n1.O=C(O)O.
What is the InChIKey of carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine?
The InChIKey is QNRQQCSYSGKYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S.CH2O3/c1-2-3-5-4-9-6(7)8-5;2-1(3)4/h2-4H,1H3,(H2,7,8);(H2,2,3,4).
What are the key properties of carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine?
carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine has a molecular weight of 202.24 g/mol, XLogP of 1.98, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;4-prop-1-enyl-1,3-thiazol-2-amine is sourced from PubChem (CID 88644555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).